C17H19F2NO3S — CID 2106216
N-(5-tert-butyl-2-methoxyphenyl)-3,4-difluorobenzenesulfonamide (PubChem CID 2106216) has the molecular formula C17H19F2NO3S and a molecular weight of 355.41 g/mol. Its IUPAC name is N-(5-tert-butyl-2-methoxyphenyl)-3,4-difluorobenzenesulfonamide.
| Compound Name | N-(5-tert-butyl-2-methoxyphenyl)-3,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 2106216 |
| Molecular Formula | C17H19F2NO3S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-(5-tert-butyl-2-methoxyphenyl)-3,4-difluorobenzenesulfonamide |
| SMILES | COc1ccc(C(C)(C)C)cc1NS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H19F2NO3S/c1-17(2,3)11-5-8-16(23-4)15(9-11)20-24(21,22)12-6-7-13(18)14(19)10-12/h5-10,20H,1-4H3 |
| InChIKey | QVANIOJXPRVMJM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |