C26H29Cl2N3O5S — CID 98651356
(5R,7R)-3-chloro-N-[2-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyanilino]-2-oxoethyl]adamantane-1-carboxamide (PubChem CID 98651356) has the molecular formula C26H29Cl2N3O5S and a molecular weight of 566.51 g/mol. Its IUPAC name is (5R,7R)-3-chloro-N-[2-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyanilino]-2-oxoethyl]adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-chloro-N-[2-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyanilino]-2-oxoethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98651356 |
| Molecular Formula | C26H29Cl2N3O5S |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | (5R,7R)-3-chloro-N-[2-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyanilino]-2-oxoethyl]adamantane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)CNC(=O)C23C[C@H]4C[C@@H](CC(Cl)(C4)C2)C3)cc1S(=O)(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C26H29Cl2N3O5S/c1-36-21-7-6-18(9-22(21)37(34,35)31-20-5-3-2-4-19(20)27)30-23(32)14-29-24(33)25-10-16-8-17(11-25)13-26(28,12-16)15-25/h2-7,9,16-17,31H,8,10-15H2,1H3,(H,29,33)(H,30,32)/t16-,17-,25?,26?/m1/s1 |
| InChIKey | HUQWHAICOOUAJL-AALNIOGOSA-N |
| XLogP | 4.78 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|