C20H27ClN2O4S — CID 9109144
(5S,7R)-3-chloro-N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]adamantane-1-carboxamide (PubChem CID 9109144) has the molecular formula C20H27ClN2O4S and a molecular weight of 426.97 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-chloro-N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 9109144 |
| Molecular Formula | C20H27ClN2O4S |
| Molecular Weight | 426.97 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | (5S,7R)-3-chloro-N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]adamantane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C23C[C@@H]4C[C@@H](CC(Cl)(C4)C2)C3)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C20H27ClN2O4S/c1-23(2)28(25,26)17-7-15(4-5-16(17)27-3)22-18(24)19-8-13-6-14(9-19)11-20(21,10-13)12-19/h4-5,7,13-14H,6,8-12H2,1-3H3,(H,22,24)/t13-,14+,19?,20? |
| InChIKey | FDCVDIDIKPHHGD-LWYUSKRHSA-N |
| XLogP | 3.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.97 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|