C18H19ClF3NO2 — CID 7957211
(5S,7R)-3-chloro-N-[4-(trifluoromethoxy)phenyl]adamantane-1-carboxamide (PubChem CID 7957211) has the molecular formula C18H19ClF3NO2 and a molecular weight of 373.80 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N-[4-(trifluoromethoxy)phenyl]adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-chloro-N-[4-(trifluoromethoxy)phenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7957211 |
| Molecular Formula | C18H19ClF3NO2 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (5S,7R)-3-chloro-N-[4-(trifluoromethoxy)phenyl]adamantane-1-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C18H19ClF3NO2/c19-17-8-11-5-12(9-17)7-16(6-11,10-17)15(24)23-13-1-3-14(4-2-13)25-18(20,21)22/h1-4,11-12H,5-10H2,(H,23,24)/t11-,12+,16?,17? |
| InChIKey | QVAQPUVYJUOMQY-GKUGFIGPSA-N |
| XLogP | 5.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|