C18H22ClNO2 — CID 7946875
(5S,7R)-3-chloro-N-(3-methoxyphenyl)adamantane-1-carboxamide (PubChem CID 7946875) has the molecular formula C18H22ClNO2 and a molecular weight of 319.83 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N-(3-methoxyphenyl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-chloro-N-(3-methoxyphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7946875 |
| Molecular Formula | C18H22ClNO2 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (5S,7R)-3-chloro-N-(3-methoxyphenyl)adamantane-1-carboxamide |
| SMILES | COc1cccc(NC(=O)C23C[C@@H]4C[C@@H](CC(Cl)(C4)C2)C3)c1 |
| InChI | InChI=1S/C18H22ClNO2/c1-22-15-4-2-3-14(6-15)20-16(21)17-7-12-5-13(8-17)10-18(19,9-12)11-17/h2-4,6,12-13H,5,7-11H2,1H3,(H,20,21)/t12-,13+,17?,18? |
| InChIKey | YOPADFPHPYTDCP-NLKGSNSHSA-N |
| XLogP | 4.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|