C23H24ClN3O — CID 7927093
(5S,7R)-3-chloro-N-(4-phenyldiazenylphenyl)adamantane-1-carboxamide (PubChem CID 7927093) has the molecular formula C23H24ClN3O and a molecular weight of 393.92 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N-(4-phenyldiazenylphenyl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-chloro-N-(4-phenyldiazenylphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7927093 |
| Molecular Formula | C23H24ClN3O |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (5S,7R)-3-chloro-N-(4-phenyldiazenylphenyl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1ccc(/N=N/c2ccccc2)cc1)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C23H24ClN3O/c24-23-13-16-10-17(14-23)12-22(11-16,15-23)21(28)25-18-6-8-20(9-7-18)27-26-19-4-2-1-3-5-19/h1-9,16-17H,10-15H2,(H,25,28)/b27-26+/t16-,17+,22?,23? |
| InChIKey | DMNSXCRPIPESIV-ITFCIJSBSA-N |
| XLogP | 6.62 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|