C20H22ClN3OS — CID 7729200
(5S,7R)-N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-chloroadamantane-1-carboxamide (PubChem CID 7729200) has the molecular formula C20H22ClN3OS and a molecular weight of 387.94 g/mol. Its IUPAC name is (5S,7R)-N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-chloroadamantane-1-carboxamide.
| Compound Name | (5S,7R)-N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-chloroadamantane-1-carboxamide |
|---|---|
| PubChem CID | 7729200 |
| Molecular Formula | C20H22ClN3OS |
| Molecular Weight | 387.94 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | (5S,7R)-N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-chloroadamantane-1-carboxamide |
| SMILES | O=C(Nc1nnc(Cc2ccccc2)s1)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C20H22ClN3OS/c21-20-10-14-6-15(11-20)9-19(8-14,12-20)17(25)22-18-24-23-16(26-18)7-13-4-2-1-3-5-13/h1-5,14-15H,6-12H2,(H,22,24,25)/t14-,15+,19?,20? |
| InChIKey | NYHIQXMONRIITM-JNKARSBBSA-N |
| XLogP | 4.65 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.94 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|