C21H27N3OS — CID 123768495
N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-phenylacetamide;ethane (PubChem CID 123768495) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-phenylacetamide;ethane.
| Compound Name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-phenylacetamide;ethane |
|---|---|
| PubChem CID | 123768495 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-phenylacetamide;ethane |
| SMILES | CC.CC.O=C(Cc1ccccc1)Nc1nnc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C17H15N3OS.2C2H6/c21-15(11-13-7-3-1-4-8-13)18-17-20-19-16(22-17)12-14-9-5-2-6-10-14;2*1-2/h1-10H,11-12H2,(H,18,20,21);2*1-2H3 |
| InChIKey | GUWTUQXHQFPUHV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |