C13H16N4OS — CID 39182812
4-amino-N-(5-benzyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 39182812) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is 4-amino-N-(5-benzyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 4-amino-N-(5-benzyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 39182812 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 4-amino-N-(5-benzyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | NCCCC(=O)Nc1nnc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C13H16N4OS/c14-8-4-7-11(18)15-13-17-16-12(19-13)9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9,14H2,(H,15,17,18) |
| InChIKey | VVPCZBHPWMCLDP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |