C13H16ClN3O2S — CID 163328991
N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-ethoxyacetamide;hydrochloride (PubChem CID 163328991) has the molecular formula C13H16ClN3O2S and a molecular weight of 313.81 g/mol. Its IUPAC name is N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-ethoxyacetamide;hydrochloride.
| Compound Name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-ethoxyacetamide;hydrochloride |
|---|---|
| PubChem CID | 163328991 |
| Molecular Formula | C13H16ClN3O2S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-ethoxyacetamide;hydrochloride |
| SMILES | CCOCC(=O)Nc1nnc(Cc2ccccc2)s1.Cl |
| InChI | InChI=1S/C13H15N3O2S.ClH/c1-2-18-9-11(17)14-13-16-15-12(19-13)8-10-6-4-3-5-7-10;/h3-7H,2,8-9H2,1H3,(H,14,16,17);1H |
| InChIKey | DTTZMJKGUCJMLK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |