C17H14FN3O2S — CID 7729168
N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-(4-fluorophenoxy)acetamide (PubChem CID 7729168) has the molecular formula C17H14FN3O2S and a molecular weight of 343.38 g/mol. Its IUPAC name is N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-(4-fluorophenoxy)acetamide.
| Compound Name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-(4-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 7729168 |
| Molecular Formula | C17H14FN3O2S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-(4-fluorophenoxy)acetamide |
| SMILES | O=C(COc1ccc(F)cc1)Nc1nnc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C17H14FN3O2S/c18-13-6-8-14(9-7-13)23-11-15(22)19-17-21-20-16(24-17)10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,19,21,22) |
| InChIKey | LHYKMMFHVFHWHQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |