C16H22Cl2N4OS — CID 119807008
7-amino-N-[5-[(3-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]heptanamide;hydrochloride (PubChem CID 119807008) has the molecular formula C16H22Cl2N4OS and a molecular weight of 389.35 g/mol. Its IUPAC name is 7-amino-N-[5-[(3-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[5-[(3-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119807008 |
| Molecular Formula | C16H22Cl2N4OS |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 7-amino-N-[5-[(3-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]heptanamide;hydrochloride |
| SMILES | Cl.NCCCCCCC(=O)Nc1nnc(Cc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C16H21ClN4OS.ClH/c17-13-7-5-6-12(10-13)11-15-20-21-16(23-15)19-14(22)8-3-1-2-4-9-18;/h5-7,10H,1-4,8-9,11,18H2,(H,19,21,22);1H |
| InChIKey | CKPFXMAXCFGKIP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|