C15H18ClN3OS — CID 2072795
N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(3-chlorophenyl)propanamide (PubChem CID 2072795) has the molecular formula C15H18ClN3OS and a molecular weight of 323.85 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(3-chlorophenyl)propanamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(3-chlorophenyl)propanamide |
|---|---|
| PubChem CID | 2072795 |
| Molecular Formula | C15H18ClN3OS |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(3-chlorophenyl)propanamide |
| SMILES | CCCCc1nnc(NC(=O)CCc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C15H18ClN3OS/c1-2-3-7-14-18-19-15(21-14)17-13(20)9-8-11-5-4-6-12(16)10-11/h4-6,10H,2-3,7-9H2,1H3,(H,17,19,20) |
| InChIKey | BOWVPLMQLGYCDN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |