C19H21ClN4OS2 — CID 55645634
2-[2-[(3-chlorophenyl)methyl]-1,3-thiazol-4-yl]-N-(5-pentyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 55645634) has the molecular formula C19H21ClN4OS2 and a molecular weight of 420.99 g/mol. Its IUPAC name is 2-[2-[(3-chlorophenyl)methyl]-1,3-thiazol-4-yl]-N-(5-pentyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[2-[(3-chlorophenyl)methyl]-1,3-thiazol-4-yl]-N-(5-pentyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 55645634 |
| Molecular Formula | C19H21ClN4OS2 |
| Molecular Weight | 420.99 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 2-[2-[(3-chlorophenyl)methyl]-1,3-thiazol-4-yl]-N-(5-pentyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCCCCc1nnc(NC(=O)Cc2csc(Cc3cccc(Cl)c3)n2)s1 |
| InChI | InChI=1S/C19H21ClN4OS2/c1-2-3-4-8-17-23-24-19(27-17)22-16(25)11-15-12-26-18(21-15)10-13-6-5-7-14(20)9-13/h5-7,9,12H,2-4,8,10-11H2,1H3,(H,22,24,25) |
| InChIKey | ODDSOSVCJSTWBC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.99 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|