C22H26FN5O2S2 — CID 55718760
2-fluoro-N-[4-[2-[(5-octyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 55718760) has the molecular formula C22H26FN5O2S2 and a molecular weight of 475.62 g/mol. Its IUPAC name is 2-fluoro-N-[4-[2-[(5-octyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2-fluoro-N-[4-[2-[(5-octyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 55718760 |
| Molecular Formula | C22H26FN5O2S2 |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 2-fluoro-N-[4-[2-[(5-octyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCCCCCCc1nnc(NC(=O)Cc2csc(NC(=O)c3ccccc3F)n2)s1 |
| InChI | InChI=1S/C22H26FN5O2S2/c1-2-3-4-5-6-7-12-19-27-28-22(32-19)25-18(29)13-15-14-31-21(24-15)26-20(30)16-10-8-9-11-17(16)23/h8-11,14H,2-7,12-13H2,1H3,(H,24,26,30)(H,25,28,29) |
| InChIKey | IDJCRLIIHCSXDU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|