C19H14ClFN4O3S — CID 55704551
N-[4-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-1,3-thiazol-2-yl]-2-fluorobenzamide (PubChem CID 55704551) has the molecular formula C19H14ClFN4O3S and a molecular weight of 432.86 g/mol. Its IUPAC name is N-[4-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-1,3-thiazol-2-yl]-2-fluorobenzamide.
| Compound Name | N-[4-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-1,3-thiazol-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 55704551 |
| Molecular Formula | C19H14ClFN4O3S |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | N-[4-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-1,3-thiazol-2-yl]-2-fluorobenzamide |
| SMILES | O=C(Cc1csc(NC(=O)c2ccccc2F)n1)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14ClFN4O3S/c20-12-7-5-11(6-8-12)17(27)25-24-16(26)9-13-10-29-19(22-13)23-18(28)14-3-1-2-4-15(14)21/h1-8,10H,9H2,(H,24,26)(H,25,27)(H,22,23,28) |
| InChIKey | XXWIRCXVBBHQFL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|