C24H18ClN3O2S — CID 41213333
4-chloro-N-[4-[2-oxo-2-(2-phenylanilino)ethyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 41213333) has the molecular formula C24H18ClN3O2S and a molecular weight of 447.95 g/mol. Its IUPAC name is 4-chloro-N-[4-[2-oxo-2-(2-phenylanilino)ethyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[4-[2-oxo-2-(2-phenylanilino)ethyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 41213333 |
| Molecular Formula | C24H18ClN3O2S |
| Molecular Weight | 447.95 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 4-chloro-N-[4-[2-oxo-2-(2-phenylanilino)ethyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Cc1csc(NC(=O)c2ccc(Cl)cc2)n1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H18ClN3O2S/c25-18-12-10-17(11-13-18)23(30)28-24-26-19(15-31-24)14-22(29)27-21-9-5-4-8-20(21)16-6-2-1-3-7-16/h1-13,15H,14H2,(H,27,29)(H,26,28,30) |
| InChIKey | IXKRESJVDIBALV-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.95 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |