C24H19N3O3S — CID 30275534
N-[4-[2-oxo-2-(2-phenoxyanilino)ethyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 30275534) has the molecular formula C24H19N3O3S and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[4-[2-oxo-2-(2-phenoxyanilino)ethyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[4-[2-oxo-2-(2-phenoxyanilino)ethyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 30275534 |
| Molecular Formula | C24H19N3O3S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-[4-[2-oxo-2-(2-phenoxyanilino)ethyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Cc1csc(NC(=O)c2ccccc2)n1)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C24H19N3O3S/c28-22(26-20-13-7-8-14-21(20)30-19-11-5-2-6-12-19)15-18-16-31-24(25-18)27-23(29)17-9-3-1-4-10-17/h1-14,16H,15H2,(H,26,28)(H,25,27,29) |
| InChIKey | YBSMLMJMUDVCFF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |