C25H21N3O4S — CID 27901869
N-[4-[2-[4-(2-methoxyphenoxy)anilino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 27901869) has the molecular formula C25H21N3O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is N-[4-[2-[4-(2-methoxyphenoxy)anilino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[4-[2-[4-(2-methoxyphenoxy)anilino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 27901869 |
| Molecular Formula | C25H21N3O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | N-[4-[2-[4-(2-methoxyphenoxy)anilino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | COc1ccccc1Oc1ccc(NC(=O)Cc2csc(NC(=O)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C25H21N3O4S/c1-31-21-9-5-6-10-22(21)32-20-13-11-18(12-14-20)26-23(29)15-19-16-33-25(27-19)28-24(30)17-7-3-2-4-8-17/h2-14,16H,15H2,1H3,(H,26,29)(H,27,28,30) |
| InChIKey | PFNTUUDZDZUYSQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |