C19H16N4O3S — CID 24658588
N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-4-benzamidobenzamide (PubChem CID 24658588) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-4-benzamidobenzamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-4-benzamidobenzamide |
|---|---|
| PubChem CID | 24658588 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-4-benzamidobenzamide |
| SMILES | NC(=O)Cc1csc(NC(=O)c2ccc(NC(=O)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C19H16N4O3S/c20-16(24)10-15-11-27-19(22-15)23-18(26)13-6-8-14(9-7-13)21-17(25)12-4-2-1-3-5-12/h1-9,11H,10H2,(H2,20,24)(H,21,25)(H,22,23,26) |
| InChIKey | SOXSCOLQTQVJDG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |