C18H15FN4O2S — CID 18139533
N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-2-(4-fluoroanilino)benzamide (PubChem CID 18139533) has the molecular formula C18H15FN4O2S and a molecular weight of 370.41 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-2-(4-fluoroanilino)benzamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-2-(4-fluoroanilino)benzamide |
|---|---|
| PubChem CID | 18139533 |
| Molecular Formula | C18H15FN4O2S |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-2-(4-fluoroanilino)benzamide |
| SMILES | NC(=O)Cc1csc(NC(=O)c2ccccc2Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H15FN4O2S/c19-11-5-7-12(8-6-11)21-15-4-2-1-3-14(15)17(25)23-18-22-13(10-26-18)9-16(20)24/h1-8,10,21H,9H2,(H2,20,24)(H,22,23,25) |
| InChIKey | NMMLDFQMRHNDPH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |