C14H15N3O3S — CID 18169150
N-[4-[2-(ethoxyamino)-2-oxoethyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 18169150) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is N-[4-[2-(ethoxyamino)-2-oxoethyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[4-[2-(ethoxyamino)-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 18169150 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-[4-[2-(ethoxyamino)-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CCONC(=O)Cc1csc(NC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C14H15N3O3S/c1-2-20-17-12(18)8-11-9-21-14(15-11)16-13(19)10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3,(H,17,18)(H,15,16,19) |
| InChIKey | ARQDAWDIILJPMS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|