C20H18N2O4S — CID 2466553
ethyl 2-[2-[(4-phenoxybenzoyl)amino]-1,3-thiazol-4-yl]acetate (PubChem CID 2466553) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is ethyl 2-[2-[(4-phenoxybenzoyl)amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(4-phenoxybenzoyl)amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 2466553 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | ethyl 2-[2-[(4-phenoxybenzoyl)amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)c2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C20H18N2O4S/c1-2-25-18(23)12-15-13-27-20(21-15)22-19(24)14-8-10-17(11-9-14)26-16-6-4-3-5-7-16/h3-11,13H,2,12H2,1H3,(H,21,22,24) |
| InChIKey | SJYHULIMRTXCSK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |