C21H20N4O3S — CID 46461718
3-[[2-(2-benzamido-1,3-thiazol-4-yl)acetyl]amino]-N,2-dimethylbenzamide (PubChem CID 46461718) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is 3-[[2-(2-benzamido-1,3-thiazol-4-yl)acetyl]amino]-N,2-dimethylbenzamide.
| Compound Name | 3-[[2-(2-benzamido-1,3-thiazol-4-yl)acetyl]amino]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 46461718 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 3-[[2-(2-benzamido-1,3-thiazol-4-yl)acetyl]amino]-N,2-dimethylbenzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)Cc2csc(NC(=O)c3ccccc3)n2)c1C |
| InChI | InChI=1S/C21H20N4O3S/c1-13-16(20(28)22-2)9-6-10-17(13)24-18(26)11-15-12-29-21(23-15)25-19(27)14-7-4-3-5-8-14/h3-10,12H,11H2,1-2H3,(H,22,28)(H,24,26)(H,23,25,27) |
| InChIKey | KMWYKWICGNHXLM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |