C22H20N4O3S — CID 55413439
2-[[2-(2-benzamido-1,3-thiazol-4-yl)acetyl]amino]-N-prop-2-enylbenzamide (PubChem CID 55413439) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is 2-[[2-(2-benzamido-1,3-thiazol-4-yl)acetyl]amino]-N-prop-2-enylbenzamide.
| Compound Name | 2-[[2-(2-benzamido-1,3-thiazol-4-yl)acetyl]amino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 55413439 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-[[2-(2-benzamido-1,3-thiazol-4-yl)acetyl]amino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=O)Cc1csc(NC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C22H20N4O3S/c1-2-12-23-21(29)17-10-6-7-11-18(17)25-19(27)13-16-14-30-22(24-16)26-20(28)15-8-4-3-5-9-15/h2-11,14H,1,12-13H2,(H,23,29)(H,25,27)(H,24,26,28) |
| InChIKey | HTPKEOPNSTZWJR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|