C14H14ClN3O2S — CID 41230136
4-chloro-N-[4-[2-(ethylamino)-2-oxoethyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 41230136) has the molecular formula C14H14ClN3O2S and a molecular weight of 323.81 g/mol. Its IUPAC name is 4-chloro-N-[4-[2-(ethylamino)-2-oxoethyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[4-[2-(ethylamino)-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 41230136 |
| Molecular Formula | C14H14ClN3O2S |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 4-chloro-N-[4-[2-(ethylamino)-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CCNC(=O)Cc1csc(NC(=O)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C14H14ClN3O2S/c1-2-16-12(19)7-11-8-21-14(17-11)18-13(20)9-3-5-10(15)6-4-9/h3-6,8H,2,7H2,1H3,(H,16,19)(H,17,18,20) |
| InChIKey | BTTYETROMBDVKL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |