C16H10Cl2N2OS — CID 19194946
4-chloro-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 19194946) has the molecular formula C16H10Cl2N2OS and a molecular weight of 349.24 g/mol. Its IUPAC name is 4-chloro-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 19194946 |
| Molecular Formula | C16H10Cl2N2OS |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 4-chloro-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(-c2ccccc2Cl)cs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H10Cl2N2OS/c17-11-7-5-10(6-8-11)15(21)20-16-19-14(9-22-16)12-3-1-2-4-13(12)18/h1-9H,(H,19,20,21) |
| InChIKey | ANIHCFBPBGNMRC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |