C21H21ClN4OS — CID 162386859
N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-4-(4-methylpiperazin-1-yl)benzamide (PubChem CID 162386859) has the molecular formula C21H21ClN4OS and a molecular weight of 412.95 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-4-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-4-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 162386859 |
| Molecular Formula | C21H21ClN4OS |
| Molecular Weight | 412.95 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-4-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3nc(-c4ccccc4Cl)cs3)cc2)CC1 |
| InChI | InChI=1S/C21H21ClN4OS/c1-25-10-12-26(13-11-25)16-8-6-15(7-9-16)20(27)24-21-23-19(14-28-21)17-4-2-3-5-18(17)22/h2-9,14H,10-13H2,1H3,(H,23,24,27) |
| InChIKey | SYKSYZXOBHQFTJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.95 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |