C16H9Cl3N2OS — CID 35523547
2,6-dichloro-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 35523547) has the molecular formula C16H9Cl3N2OS and a molecular weight of 383.69 g/mol. Its IUPAC name is 2,6-dichloro-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2,6-dichloro-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 35523547 |
| Molecular Formula | C16H9Cl3N2OS |
| Molecular Weight | 383.69 g/mol |
| Exact Mass | 381.95 |
| IUPAC Name | 2,6-dichloro-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(-c2ccccc2Cl)cs1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H9Cl3N2OS/c17-10-5-2-1-4-9(10)13-8-23-16(20-13)21-15(22)14-11(18)6-3-7-12(14)19/h1-8H,(H,20,21,22) |
| InChIKey | SALOXINQFLGUGI-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.69 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |