C24H14ClN3O3S — CID 19197399
N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-4-(1,3-dioxoisoindol-2-yl)benzamide (PubChem CID 19197399) has the molecular formula C24H14ClN3O3S and a molecular weight of 459.91 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-4-(1,3-dioxoisoindol-2-yl)benzamide.
| Compound Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-4-(1,3-dioxoisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 19197399 |
| Molecular Formula | C24H14ClN3O3S |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-4-(1,3-dioxoisoindol-2-yl)benzamide |
| SMILES | O=C(Nc1nc(-c2ccccc2Cl)cs1)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H14ClN3O3S/c25-19-8-4-3-7-18(19)20-13-32-24(26-20)27-21(29)14-9-11-15(12-10-14)28-22(30)16-5-1-2-6-17(16)23(28)31/h1-13H,(H,26,27,29) |
| InChIKey | OAHKNHJQDBRMKE-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|