C25H17N3O4S — CID 19197395
4-(1,3-dioxoisoindol-2-yl)-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 19197395) has the molecular formula C25H17N3O4S and a molecular weight of 455.50 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 19197395 |
| Molecular Formula | C25H17N3O4S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | COc1cccc(-c2csc(NC(=O)c3ccc(N4C(=O)c5ccccc5C4=O)cc3)n2)c1 |
| InChI | InChI=1S/C25H17N3O4S/c1-32-18-6-4-5-16(13-18)21-14-33-25(26-21)27-22(29)15-9-11-17(12-10-15)28-23(30)19-7-2-3-8-20(19)24(28)31/h2-14H,1H3,(H,26,27,29) |
| InChIKey | GYRXJLZDIHWXLZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|