C23H14N4O3S — CID 108766703
4-(1,3-dioxoisoindol-2-yl)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 108766703) has the molecular formula C23H14N4O3S and a molecular weight of 426.46 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 108766703 |
| Molecular Formula | C23H14N4O3S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc(-c2ccccn2)cs1)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H14N4O3S/c28-20(26-23-25-19(13-31-23)18-7-3-4-12-24-18)14-8-10-15(11-9-14)27-21(29)16-5-1-2-6-17(16)22(27)30/h1-13H,(H,25,26,28) |
| InChIKey | RAYMWQMZZUIJDX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|