C17H12N6OS — CID 8891885
2-phenyl-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)triazole-4-carboxamide (PubChem CID 8891885) has the molecular formula C17H12N6OS and a molecular weight of 348.39 g/mol. Its IUPAC name is 2-phenyl-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)triazole-4-carboxamide.
| Compound Name | 2-phenyl-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 8891885 |
| Molecular Formula | C17H12N6OS |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-phenyl-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)triazole-4-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccccn2)cs1)c1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H12N6OS/c24-16(14-10-19-23(22-14)12-6-2-1-3-7-12)21-17-20-15(11-25-17)13-8-4-5-9-18-13/h1-11H,(H,20,21,24) |
| InChIKey | GQESHPMPYWBYQZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |