C24H17N5OS — CID 122286360
2-phenyl-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]triazole-4-carboxamide (PubChem CID 122286360) has the molecular formula C24H17N5OS and a molecular weight of 423.50 g/mol. Its IUPAC name is 2-phenyl-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]triazole-4-carboxamide.
| Compound Name | 2-phenyl-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 122286360 |
| Molecular Formula | C24H17N5OS |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-phenyl-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]triazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(-c2csc(-c3ccccc3)n2)cc1)c1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H17N5OS/c30-23(21-15-25-29(28-21)20-9-5-2-6-10-20)26-19-13-11-17(12-14-19)22-16-31-24(27-22)18-7-3-1-4-8-18/h1-16H,(H,26,30) |
| InChIKey | UIFSXDOHDFFAFI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |