C22H13N3O3S — CID 1248679
N-(1,3-benzothiazol-2-yl)-4-(1,3-dioxoisoindol-2-yl)benzamide (PubChem CID 1248679) has the molecular formula C22H13N3O3S and a molecular weight of 399.43 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-(1,3-dioxoisoindol-2-yl)benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-(1,3-dioxoisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 1248679 |
| Molecular Formula | C22H13N3O3S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-(1,3-dioxoisoindol-2-yl)benzamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H13N3O3S/c26-19(24-22-23-17-7-3-4-8-18(17)29-22)13-9-11-14(12-10-13)25-20(27)15-5-1-2-6-16(15)21(25)28/h1-12H,(H,23,24,26) |
| InChIKey | CEUQCBBAOIHVCK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|