C18H11N3O3S — CID 940171
4-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 940171) has the molecular formula C18H11N3O3S and a molecular weight of 349.37 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 940171 |
| Molecular Formula | C18H11N3O3S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C18H11N3O3S/c22-15(20-18-19-9-10-25-18)11-5-7-12(8-6-11)21-16(23)13-3-1-2-4-14(13)17(21)24/h1-10H,(H,19,20,22) |
| InChIKey | XFZJBYBYUPLLQC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|