C19H13N3O3S — CID 66491223
2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 66491223) has the molecular formula C19H13N3O3S and a molecular weight of 363.40 g/mol. Its IUPAC name is 2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 66491223 |
| Molecular Formula | C19H13N3O3S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Cc1ccc(N2C(=O)c3ccccc3C2=O)cc1)Nc1nccs1 |
| InChI | InChI=1S/C19H13N3O3S/c23-16(21-19-20-9-10-26-19)11-12-5-7-13(8-6-12)22-17(24)14-3-1-2-4-15(14)18(22)25/h1-10H,11H2,(H,20,21,23) |
| InChIKey | NXYWUFXUHJUXAD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|