C12H12N2OS — CID 6468138
2-(3-methylphenyl)-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 6468138) has the molecular formula C12H12N2OS and a molecular weight of 232.31 g/mol. Its IUPAC name is 2-(3-methylphenyl)-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(3-methylphenyl)-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 6468138 |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2-(3-methylphenyl)-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1cccc(CC(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C12H12N2OS/c1-9-3-2-4-10(7-9)8-11(15)14-12-13-5-6-16-12/h2-7H,8H2,1H3,(H,13,14,15) |
| InChIKey | GILNZSBQKMZFIX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |