C22H15FN2O3 — CID 110343512
2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-N-(3-fluorophenyl)acetamide (PubChem CID 110343512) has the molecular formula C22H15FN2O3 and a molecular weight of 374.37 g/mol. Its IUPAC name is 2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 110343512 |
| Molecular Formula | C22H15FN2O3 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-N-(3-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(N2C(=O)c3ccccc3C2=O)cc1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C22H15FN2O3/c23-15-4-3-5-16(13-15)24-20(26)12-14-8-10-17(11-9-14)25-21(27)18-6-1-2-7-19(18)22(25)28/h1-11,13H,12H2,(H,24,26) |
| InChIKey | OMBXSXWVFVOGIO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|