C21H15N3O3 — CID 113082993
N-[3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)phenyl]-2-phenylacetamide (PubChem CID 113082993) has the molecular formula C21H15N3O3 and a molecular weight of 357.37 g/mol. Its IUPAC name is N-[3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)phenyl]-2-phenylacetamide.
| Compound Name | N-[3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 113082993 |
| Molecular Formula | C21H15N3O3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-[3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)phenyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1cccc(N2C(=O)c3cccnc3C2=O)c1 |
| InChI | InChI=1S/C21H15N3O3/c25-18(12-14-6-2-1-3-7-14)23-15-8-4-9-16(13-15)24-20(26)17-10-5-11-22-19(17)21(24)27/h1-11,13H,12H2,(H,23,25) |
| InChIKey | BILWJIAKLRSKCI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|