C25H22N2O6 — CID 56507447
N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 56507447) has the molecular formula C25H22N2O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 56507447 |
| Molecular Formula | C25H22N2O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(CC(=O)Nc2cccc(N3C(=O)c4ccccc4C3=O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C25H22N2O6/c1-31-20-11-15(12-21(32-2)23(20)33-3)13-22(28)26-16-7-6-8-17(14-16)27-24(29)18-9-4-5-10-19(18)25(27)30/h4-12,14H,13H2,1-3H3,(H,26,28) |
| InChIKey | VQHRMRNYLRPTAD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|