C23H19NO5 — CID 168517559
2-[3-(3,4,5-trimethoxyphenyl)phenyl]isoindole-1,3-dione (PubChem CID 168517559) has the molecular formula C23H19NO5 and a molecular weight of 389.41 g/mol. Its IUPAC name is 2-[3-(3,4,5-trimethoxyphenyl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(3,4,5-trimethoxyphenyl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168517559 |
| Molecular Formula | C23H19NO5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-[3-(3,4,5-trimethoxyphenyl)phenyl]isoindole-1,3-dione |
| SMILES | COc1cc(-c2cccc(N3C(=O)c4ccccc4C3=O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C23H19NO5/c1-27-19-12-15(13-20(28-2)21(19)29-3)14-7-6-8-16(11-14)24-22(25)17-9-4-5-10-18(17)23(24)26/h4-13H,1-3H3 |
| InChIKey | NDRXPVAWXKPLBT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|