4-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzoic acid

C21H13NO4 — CID 168517547

IUPAC4-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzoic acid
SMILESO=C(O)c1ccc(-c2cccc(N3C(=O)c4ccccc4C3=O)c2)cc1
InChIInChI=1S/C21H13NO4/c23-19-17-6-1-2-7-18(17)20(24)22(19)16-5-3-4-15(12-16)13-8-10-14(11-9-13)21(25)26/h1-12H,(H,25,26)
InChIKeyCATAELMBKMITHP-UHFFFAOYSA-N
MW343.34 g/mol
LogP3.85
Rot. Bonds3

About 4-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzoic acid

4-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzoic acid (PubChem CID 168517547) has the molecular formula C21H13NO4 and a molecular weight of 343.34 g/mol. Its IUPAC name is 4-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzoic acid.

Molecular Properties

Compound Name4-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzoic acid
PubChem CID168517547
Molecular FormulaC21H13NO4
Molecular Weight343.34 g/mol
Exact Mass343.08
IUPAC Name4-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzoic acid
SMILESO=C(O)c1ccc(-c2cccc(N3C(=O)c4ccccc4C3=O)c2)cc1
InChIInChI=1S/C21H13NO4/c23-19-17-6-1-2-7-18(17)20(24)22(19)16-5-3-4-15(12-16)13-8-10-14(11-9-13)21(25)26/h1-12H,(H,25,26)
InChIKeyCATAELMBKMITHP-UHFFFAOYSA-N
XLogP3.85
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms26
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500343.34
LogP ≤ 53.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 4-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzoic acid?
The IUPAC name of 4-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzoic acid (CID 168517547) is 4-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzoic acid.
What is the SMILES notation for 4-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzoic acid?
The canonical SMILES for 4-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzoic acid is O=C(O)c1ccc(-c2cccc(N3C(=O)c4ccccc4C3=O)c2)cc1.
What is the InChIKey of 4-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzoic acid?
The InChIKey is CATAELMBKMITHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13NO4/c23-19-17-6-1-2-7-18(17)20(24)22(19)16-5-3-4-15(12-16)13-8-10-14(11-9-13)21(25)26/h1-12H,(H,25,26).
What are the key properties of 4-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzoic acid?
4-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzoic acid has a molecular weight of 343.34 g/mol, XLogP of 3.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzoic acid is sourced from PubChem (CID 168517547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).