C18H16N2O5 — CID 139070471
N,N-dimethylformamide;4-(1,3-dioxoisoindol-2-yl)benzoic acid (PubChem CID 139070471) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is N,N-dimethylformamide;4-(1,3-dioxoisoindol-2-yl)benzoic acid.
| Compound Name | N,N-dimethylformamide;4-(1,3-dioxoisoindol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 139070471 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N,N-dimethylformamide;4-(1,3-dioxoisoindol-2-yl)benzoic acid |
| SMILES | CN(C)C=O.O=C(O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C15H9NO4.C3H7NO/c17-13-11-3-1-2-4-12(11)14(18)16(13)10-7-5-9(6-8-10)15(19)20;1-4(2)3-5/h1-8H,(H,19,20);3H,1-2H3 |
| InChIKey | GWZJEJOXVLDATF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|