C19H17NO4 — CID 1211700
4-(5-tert-butyl-1,3-dioxoisoindol-2-yl)benzoic acid (PubChem CID 1211700) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is 4-(5-tert-butyl-1,3-dioxoisoindol-2-yl)benzoic acid.
| Compound Name | 4-(5-tert-butyl-1,3-dioxoisoindol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 1211700 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 4-(5-tert-butyl-1,3-dioxoisoindol-2-yl)benzoic acid |
| SMILES | CC(C)(C)c1ccc2c(c1)C(=O)N(c1ccc(C(=O)O)cc1)C2=O |
| InChI | InChI=1S/C19H17NO4/c1-19(2,3)12-6-9-14-15(10-12)17(22)20(16(14)21)13-7-4-11(5-8-13)18(23)24/h4-10H,1-3H3,(H,23,24) |
| InChIKey | QIZDHZMUNRZKRJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|