C34H26N2O5 — CID 126699479
2-[4-[(4-tert-butylphenyl)methyl]phenyl]-5-(1,3-dioxoisoindole-5-carbonyl)isoindole-1,3-dione (PubChem CID 126699479) has the molecular formula C34H26N2O5 and a molecular weight of 542.59 g/mol. Its IUPAC name is 2-[4-[(4-tert-butylphenyl)methyl]phenyl]-5-(1,3-dioxoisoindole-5-carbonyl)isoindole-1,3-dione.
| Compound Name | 2-[4-[(4-tert-butylphenyl)methyl]phenyl]-5-(1,3-dioxoisoindole-5-carbonyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 126699479 |
| Molecular Formula | C34H26N2O5 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | 2-[4-[(4-tert-butylphenyl)methyl]phenyl]-5-(1,3-dioxoisoindole-5-carbonyl)isoindole-1,3-dione |
| SMILES | CC(C)(C)c1ccc(Cc2ccc(N3C(=O)c4ccc(C(=O)c5ccc6c(c5)C(=O)NC6=O)cc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C34H26N2O5/c1-34(2,3)23-10-4-19(5-11-23)16-20-6-12-24(13-7-20)36-32(40)26-15-9-22(18-28(26)33(36)41)29(37)21-8-14-25-27(17-21)31(39)35-30(25)38/h4-15,17-18H,16H2,1-3H3,(H,35,38,39) |
| InChIKey | GJJAABKUOSHYIC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|