C40H32N2O4 — CID 166033731
5-(1,3-dioxoisoindol-5-yl)-2-[4-[2-[3-(2-phenylpropan-2-yl)phenyl]propan-2-yl]phenyl]isoindole-1,3-dione (PubChem CID 166033731) has the molecular formula C40H32N2O4 and a molecular weight of 604.71 g/mol. Its IUPAC name is 5-(1,3-dioxoisoindol-5-yl)-2-[4-[2-[3-(2-phenylpropan-2-yl)phenyl]propan-2-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 5-(1,3-dioxoisoindol-5-yl)-2-[4-[2-[3-(2-phenylpropan-2-yl)phenyl]propan-2-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166033731 |
| Molecular Formula | C40H32N2O4 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | 5-(1,3-dioxoisoindol-5-yl)-2-[4-[2-[3-(2-phenylpropan-2-yl)phenyl]propan-2-yl]phenyl]isoindole-1,3-dione |
| SMILES | CC(C)(c1ccccc1)c1cccc(C(C)(C)c2ccc(N3C(=O)c4ccc(-c5ccc6c(c5)C(=O)NC6=O)cc4C3=O)cc2)c1 |
| InChI | InChI=1S/C40H32N2O4/c1-39(2,26-9-6-5-7-10-26)28-11-8-12-29(23-28)40(3,4)27-15-17-30(18-16-27)42-37(45)32-20-14-25(22-34(32)38(42)46)24-13-19-31-33(21-24)36(44)41-35(31)43/h5-23H,1-4H3,(H,41,43,44) |
| InChIKey | YJBOBRPCMBHFNG-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|