C35H23N3O4 — CID 132941710
4-(1,3-dioxoisoindol-5-yl)-2-[4-(N-(4-methylphenyl)anilino)phenyl]isoindole-1,3-dione (PubChem CID 132941710) has the molecular formula C35H23N3O4 and a molecular weight of 549.59 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-5-yl)-2-[4-(N-(4-methylphenyl)anilino)phenyl]isoindole-1,3-dione.
| Compound Name | 4-(1,3-dioxoisoindol-5-yl)-2-[4-(N-(4-methylphenyl)anilino)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 132941710 |
| Molecular Formula | C35H23N3O4 |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | 4-(1,3-dioxoisoindol-5-yl)-2-[4-(N-(4-methylphenyl)anilino)phenyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(N(c2ccccc2)c2ccc(N3C(=O)c4cccc(-c5ccc6c(c5)C(=O)NC6=O)c4C3=O)cc2)cc1 |
| InChI | InChI=1S/C35H23N3O4/c1-21-10-13-24(14-11-21)37(23-6-3-2-4-7-23)25-15-17-26(18-16-25)38-34(41)29-9-5-8-27(31(29)35(38)42)22-12-19-28-30(20-22)33(40)36-32(28)39/h2-20H,1H3,(H,36,39,40) |
| InChIKey | DNYLANJKYQRPPR-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|