C48H33N3O2 — CID 174974437
4,5-bis[4-(N-phenylanilino)phenyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 174974437) has the molecular formula C48H33N3O2 and a molecular weight of 683.81 g/mol. Its IUPAC name is 4,5-bis[4-(N-phenylanilino)phenyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 4,5-bis[4-(N-phenylanilino)phenyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 174974437 |
| Molecular Formula | C48H33N3O2 |
| Molecular Weight | 683.81 g/mol |
| Exact Mass | 683.26 |
| IUPAC Name | 4,5-bis[4-(N-phenylanilino)phenyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1NC(=O)c2c(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)c(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc3cccc1c23 |
| InChI | InChI=1S/C48H33N3O2/c52-47-42-23-13-14-35-32-43(33-24-28-40(29-25-33)50(36-15-5-1-6-16-36)37-17-7-2-8-18-37)44(46(45(35)42)48(53)49-47)34-26-30-41(31-27-34)51(38-19-9-3-10-20-38)39-21-11-4-12-22-39/h1-32H,(H,49,52,53) |
| InChIKey | IEGGXPYRFYPBDO-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.81 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|