C24H16N2O2 — CID 140906853
4-(N-phenylanilino)benzo[de]isoquinoline-1,3-dione (PubChem CID 140906853) has the molecular formula C24H16N2O2 and a molecular weight of 364.40 g/mol. Its IUPAC name is 4-(N-phenylanilino)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 4-(N-phenylanilino)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 140906853 |
| Molecular Formula | C24H16N2O2 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 4-(N-phenylanilino)benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1NC(=O)c2c(N(c3ccccc3)c3ccccc3)ccc3cccc1c23 |
| InChI | InChI=1S/C24H16N2O2/c27-23-19-13-7-8-16-14-15-20(22(21(16)19)24(28)25-23)26(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-15H,(H,25,27,28) |
| InChIKey | YPLOLNPGRJIXHB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|